Sumitone fast red b [40618-31-3]
Cat# NB-64-89843-50mg
Size : 50mg
Brand : Neo Biotech
Sumitone fast red b
Catalog No. T87481 Copy Product Info
Sumitone Fast Red B is a multifunctional dye. It plays a crucial role in biological experiments by aiding researchers in observing and analyzing cell structures, tracking biomolecules, evaluating cell functions, distinguishing cell types, detecting biomolecules, studying tissue pathology, and monitoring microorganisms. Its applications extend from basic scientific research to a wide range of clinical diagnostics. Additionally, dyes are essential in traditional fields like textile dyeing and emerging fields such as functional textile processing, food pigments, and dye-sensitized solar cells.
Sumitone fast red b
Copy Product InfoSumitone Fast Red B is a multifunctional dye. It plays a crucial role in biological experiments by aiding researchers in observing and analyzing cell structures, tracking biomolecules, evaluating cell functions, distinguishing cell types, detecting biomolecules, studying tissue pathology, and monitoring microorganisms. Its applications extend from basic scientific research to a wide range of clinical diagnostics. Additionally, dyes are essential in traditional fields like textile dyeing and emerging fields such as functional textile processing, food pigments, and dye-sensitized solar cells.

Cas No. 40618-31-3
Product Introduction
Bioactivity
Chemical Properties
Storage & Solubility Information
| Description | Sumitone Fast Red B is a multifunctional dye. It plays a crucial role in biological experiments by aiding researchers in observing and analyzing cell structures, tracking biomolecules, evaluating cell functions, distinguishing cell types, detecting biomolecules, studying tissue pathology, and monitoring microorganisms. Its applications extend from basic scientific research to a wide range of clinical diagnostics. Additionally, dyes are essential in traditional fields like textile dyeing and emerging fields such as functional textile processing, food pigments, and dye-sensitized solar cells. |
| Molecular Weight | 863.36 |
| Formula | C40H22Cl6N6O4 |
| Cas No. | 40618-31-3 |
| Smiles | N(=NC1=C(Cl)C=CC(Cl)=C1)C=2C3=C(C=C(C(NC4=C(Cl)C=C(NC(=O)C=5C(O)=C(N=NC6=C(Cl)C=CC(Cl)=C6)C7=C(C5)C=CC=C7)C(Cl)=C4)=O)C2O)C=CC=C3 |
| Storage | Powder: -20°C for 3 years | In solvent: -80°C for 1 year Shipping with blue ice. |

