Laminaribiose [34980-39-7]
Referência NB-64-133740-50mg
Tamanho : 50mg
Marca : Neo Biotech
Laminaribiose (Synonyms: β-D-Glc-(1-3)-D-Glc, Laminaribiose)
Catalog No. TSW-00027 Copy Product Info
Laminaribiose is a disaccharide composed of two glucose molecules linked by a β-1,3-glycosidic bond. It is commonly found in various plant cell walls and is a hydrolysis product of the polysaccharide laminarin. Laminaribiose has multiple applications in biochemical research, particularly as a substrate for enzymes involved in carbohydrate metabolism. Additionally, it serves as a carbon source for certain microorganisms and as a dietary supplement.
Laminaribiose
Copy Product InfoSynonyms β-D-Glc-(1-3)-D-Glc, Laminaribiose
Laminaribiose is a disaccharide composed of two glucose molecules linked by a β-1,3-glycosidic bond. It is commonly found in various plant cell walls and is a hydrolysis product of the polysaccharide laminarin. Laminaribiose has multiple applications in biochemical research, particularly as a substrate for enzymes involved in carbohydrate metabolism. Additionally, it serves as a carbon source for certain microorganisms and as a dietary supplement.

Cas No. 34980-39-7
Product Introduction
Bioactivity
Chemical Properties
Storage & Solubility Information
| Description | Laminaribiose is a disaccharide composed of two glucose molecules linked by a β-1,3-glycosidic bond. It is commonly found in various plant cell walls and is a hydrolysis product of the polysaccharide laminarin. Laminaribiose has multiple applications in biochemical research, particularly as a substrate for enzymes involved in carbohydrate metabolism. Additionally, it serves as a carbon source for certain microorganisms and as a dietary supplement. |
| Synonyms | β-D-Glc-(1-3)-D-Glc, Laminaribiose |
| Molecular Weight | 342.2965 |
| Formula | C12H22O11 |
| Cas No. | 34980-39-7 |
| Smiles | OC[C@@H](O)[C@@H](O)[C@@H]([C@@H](O)C=O)O[C@@H]1O[C@@H]([C@H]([C@@H]([C@H]1O)O)O)CO |
| Storage | Powder: -20°C for 3 years | In solvent: -80°C for 1 year |

